About methyl 4-nitrobutanoate
methyl 4-nitrobutanoate (PubChem CID 25604) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is methyl 4-nitrobutanoate.
Molecular Properties
| Compound Name | methyl 4-nitrobutanoate |
| PubChem CID | 25604 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | methyl 4-nitrobutanoate |
| SMILES | COC(=O)CCC[N+](=O)[O-] |
| InChI | InChI=1S/C5H9NO4/c1-10-5(7)3-2-4-6(8)9/h2-4H2,1H3 |
| InChIKey | UBSPKGKFFQKZJB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-nitrobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-nitrobutanoate?
The IUPAC name of methyl 4-nitrobutanoate (CID 25604) is methyl 4-nitrobutanoate.
What is the SMILES notation for methyl 4-nitrobutanoate?
The canonical SMILES for methyl 4-nitrobutanoate is COC(=O)CCC[N+](=O)[O-].
What is the InChIKey of methyl 4-nitrobutanoate?
The InChIKey is UBSPKGKFFQKZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4/c1-10-5(7)3-2-4-6(8)9/h2-4H2,1H3.
What are the key properties of methyl 4-nitrobutanoate?
methyl 4-nitrobutanoate has a molecular weight of 147.13 g/mol, XLogP of 0.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-nitrobutanoate is sourced from PubChem (CID 25604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).