C10H9F5N2 — CID 2561708
1-(2,3,4,5,6-pentafluorophenyl)piperazine (PubChem CID 2561708) has the molecular formula C10H9F5N2 and a molecular weight of 252.19 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)piperazine.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)piperazine |
|---|---|
| PubChem CID | 2561708 |
| Molecular Formula | C10H9F5N2 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)piperazine |
| SMILES | Fc1c(F)c(F)c(N2CCNCC2)c(F)c1F |
| InChI | InChI=1S/C10H9F5N2/c11-5-6(12)8(14)10(9(15)7(5)13)17-3-1-16-2-4-17/h16H,1-4H2 |
| InChIKey | IXHIQLUASOVALJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|