C13H14ClN5O3S — CID 2562649
2-(4-chlorophenoxy)-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]acetohydrazide (PubChem CID 2562649) has the molecular formula C13H14ClN5O3S and a molecular weight of 355.81 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]acetohydrazide.
| Compound Name | 2-(4-chlorophenoxy)-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 2562649 |
| Molecular Formula | C13H14ClN5O3S |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2-(4-chlorophenoxy)-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]acetohydrazide |
| SMILES | Cn1cnnc1SCC(=O)NNC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN5O3S/c1-19-8-15-18-13(19)23-7-12(21)17-16-11(20)6-22-10-4-2-9(14)3-5-10/h2-5,8H,6-7H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | XJTKGPUQEXAAQD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|