C19H17F4N3O5 — CID 2563637
(2R)-2-(5-fluoro-2-nitrophenoxy)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide (PubChem CID 2563637) has the molecular formula C19H17F4N3O5 and a molecular weight of 443.35 g/mol. Its IUPAC name is (2R)-2-(5-fluoro-2-nitrophenoxy)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide.
| Compound Name | (2R)-2-(5-fluoro-2-nitrophenoxy)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide |
|---|---|
| PubChem CID | 2563637 |
| Molecular Formula | C19H17F4N3O5 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (2R)-2-(5-fluoro-2-nitrophenoxy)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide |
| SMILES | C[C@@H](Oc1cc(F)ccc1[N+](=O)[O-])C(=O)N(C)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H17F4N3O5/c1-11(31-16-9-12(20)7-8-15(16)26(29)30)18(28)25(2)10-17(27)24-14-6-4-3-5-13(14)19(21,22)23/h3-9,11H,10H2,1-2H3,(H,24,27)/t11-/m1/s1 |
| InChIKey | XMHISVYXUHQDBN-LLVKDONJSA-N |
| XLogP | 3.62 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|