C12H15NO — CID 25652
2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 25652) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 25652 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | NC(=O)Cc1cccc2c1CCCC2 |
| InChI | InChI=1S/C12H15NO/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h3,5-6H,1-2,4,7-8H2,(H2,13,14) |
| InChIKey | HOXDVJHMSBALCX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |