C16H19F3N4S — CID 2565946
4-cyclohexyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 2565946) has the molecular formula C16H19F3N4S and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-cyclohexyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclohexyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2565946 |
| Molecular Formula | C16H19F3N4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-cyclohexyl-3-[[3-(trifluoromethyl)anilino]methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)(F)c1cccc(NCc2n[nH]c(=S)n2C2CCCCC2)c1 |
| InChI | InChI=1S/C16H19F3N4S/c17-16(18,19)11-5-4-6-12(9-11)20-10-14-21-22-15(24)23(14)13-7-2-1-3-8-13/h4-6,9,13,20H,1-3,7-8,10H2,(H,22,24) |
| InChIKey | FXZFKGDBRDZYRV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|