About (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate
(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate (PubChem CID 2566) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate |
| PubChem CID | 2566 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C12H15NO3/c1-12(2)7-8-5-4-6-9(10(8)16-12)15-11(14)13-3/h4-6H,7H2,1-3H3,(H,13,14) |
| InChIKey | DUEPRVBVGDRKAG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate?
The IUPAC name of (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate (CID 2566) is (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate.
What is the SMILES notation for (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate?
The canonical SMILES for (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate is CNC(=O)Oc1cccc2c1OC(C)(C)C2.
What is the InChIKey of (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate?
The InChIKey is DUEPRVBVGDRKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-12(2)7-8-5-4-6-9(10(8)16-12)15-11(14)13-3/h4-6H,7H2,1-3H3,(H,13,14).
What are the key properties of (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate?
(2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate has a molecular weight of 221.26 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate is sourced from PubChem (CID 2566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).