About N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide
N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 2566493) has the molecular formula C17H20N2O4S
and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide |
| PubChem CID | 2566493 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CN(C)C(=O)CNC(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C17H20N2O4S/c1-19(11-12-6-7-13(22-2)9-14(12)23-3)16(20)10-18-17(21)15-5-4-8-24-15/h4-9H,10-11H2,1-3H3,(H,18,21) |
| InChIKey | ZLVPZTWBEHSRIF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide?
The IUPAC name of N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide (CID 2566493) is N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide?
The canonical SMILES for N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide is COc1ccc(CN(C)C(=O)CNC(=O)c2cccs2)c(OC)c1.
What is the InChIKey of N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide?
The InChIKey is ZLVPZTWBEHSRIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4S/c1-19(11-12-6-7-13(22-2)9-14(12)23-3)16(20)10-18-17(21)15-5-4-8-24-15/h4-9H,10-11H2,1-3H3,(H,18,21).
What are the key properties of N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide?
N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide has a molecular weight of 348.42 g/mol, XLogP of 2.15, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl]thiophene-2-carboxamide is sourced from PubChem (CID 2566493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).