About [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate
[2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 2567972) has the molecular formula C11H12Cl2N2OS2
and a molecular weight of 323.27 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
| PubChem CID | 2567972 |
| Molecular Formula | C11H12Cl2N2OS2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2OS2/c1-15(2)11(17)18-6-10(16)14-9-4-3-7(12)5-8(9)13/h3-5H,6H2,1-2H3,(H,14,16) |
| InChIKey | UJLZPCLUHVKGSK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate?
The IUPAC name of [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate (CID 2567972) is [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate.
What is the SMILES notation for [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate?
The canonical SMILES for [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate is CN(C)C(=S)SCC(=O)Nc1ccc(Cl)cc1Cl.
What is the InChIKey of [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate?
The InChIKey is UJLZPCLUHVKGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2OS2/c1-15(2)11(17)18-6-10(16)14-9-4-3-7(12)5-8(9)13/h3-5H,6H2,1-2H3,(H,14,16).
What are the key properties of [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate?
[2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate has a molecular weight of 323.27 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate is sourced from PubChem (CID 2567972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).