About N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide
N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide (PubChem CID 2569039) has the molecular formula C24H19FN2OS
and a molecular weight of 402.49 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide |
| PubChem CID | 2569039 |
| Molecular Formula | C24H19FN2OS |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1ccc(-c2sc(-c3ccccc3)nc2CC(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C24H19FN2OS/c1-16-11-13-17(14-12-16)23-21(27-24(29-23)18-7-3-2-4-8-18)15-22(28)26-20-10-6-5-9-19(20)25/h2-14H,15H2,1H3,(H,26,28) |
| InChIKey | KKFKZTYABBRFHY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
The IUPAC name of N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide (CID 2569039) is N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide.
What is the SMILES notation for N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
The canonical SMILES for N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide is Cc1ccc(-c2sc(-c3ccccc3)nc2CC(=O)Nc2ccccc2F)cc1.
What is the InChIKey of N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
The InChIKey is KKFKZTYABBRFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19FN2OS/c1-16-11-13-17(14-12-16)23-21(27-24(29-23)18-7-3-2-4-8-18)15-22(28)26-20-10-6-5-9-19(20)25/h2-14H,15H2,1H3,(H,26,28).
What are the key properties of N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide?
N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide has a molecular weight of 402.49 g/mol, XLogP of 6.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-2-[5-(4-methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetamide is sourced from PubChem (CID 2569039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).