C18H19F3N2O3S2 — CID 2569203
2-[(2Z,5E)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 2569203) has the molecular formula C18H19F3N2O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 2-[(2Z,5E)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(2Z,5E)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 2569203 |
| Molecular Formula | C18H19F3N2O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[(2Z,5E)-2-(3,3-dimethyl-2-oxobutylidene)-4-oxo-5-(thiophen-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(C)(C)C(=O)/C=c1\s/c(=C/c2ccsc2)c(=O)n1CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O3S2/c1-17(2,3)13(24)7-15-23(8-14(25)22-10-18(19,20)21)16(26)12(28-15)6-11-4-5-27-9-11/h4-7,9H,8,10H2,1-3H3,(H,22,25)/b12-6+,15-7- |
| InChIKey | XTMCJWRLLQFKRG-XTXNDRQPSA-N |
| XLogP | 1.87 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |