About pentyl 4-aminobenzoate
pentyl 4-aminobenzoate (PubChem CID 25706) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is pentyl 4-aminobenzoate.
Molecular Properties
| Compound Name | pentyl 4-aminobenzoate |
| PubChem CID | 25706 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | pentyl 4-aminobenzoate |
| SMILES | CCCCCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-9-15-12(14)10-5-7-11(13)8-6-10/h5-8H,2-4,9,13H2,1H3 |
| InChIKey | VKYWCHMXHQTCJQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze pentyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 4-aminobenzoate?
The IUPAC name of pentyl 4-aminobenzoate (CID 25706) is pentyl 4-aminobenzoate.
What is the SMILES notation for pentyl 4-aminobenzoate?
The canonical SMILES for pentyl 4-aminobenzoate is CCCCCOC(=O)c1ccc(N)cc1.
What is the InChIKey of pentyl 4-aminobenzoate?
The InChIKey is VKYWCHMXHQTCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-2-3-4-9-15-12(14)10-5-7-11(13)8-6-10/h5-8H,2-4,9,13H2,1H3.
What are the key properties of pentyl 4-aminobenzoate?
pentyl 4-aminobenzoate has a molecular weight of 207.27 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 4-aminobenzoate is sourced from PubChem (CID 25706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).