C19H19N3O6 — CID 2570750
N-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide (PubChem CID 2570750) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 2570750 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[4-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CCCCN1C(=O)C(=O)N(Cc2cc(=O)oc3cc(NC(C)=O)ccc23)C1=O |
| InChI | InChI=1S/C19H19N3O6/c1-3-4-7-21-17(25)18(26)22(19(21)27)10-12-8-16(24)28-15-9-13(20-11(2)23)5-6-14(12)15/h5-6,8-9H,3-4,7,10H2,1-2H3,(H,20,23) |
| InChIKey | ZIXGIXBCLPIZDF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|