About 3-methyl-1,1-diphenylurea
3-methyl-1,1-diphenylurea (PubChem CID 25711) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-methyl-1,1-diphenylurea.
Molecular Properties
| Compound Name | 3-methyl-1,1-diphenylurea |
| PubChem CID | 25711 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-methyl-1,1-diphenylurea |
| SMILES | CNC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2O/c1-15-14(17)16(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H,15,17) |
| InChIKey | IMFYAZJNDOZIFV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-1,1-diphenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,1-diphenylurea?
The IUPAC name of 3-methyl-1,1-diphenylurea (CID 25711) is 3-methyl-1,1-diphenylurea.
What is the SMILES notation for 3-methyl-1,1-diphenylurea?
The canonical SMILES for 3-methyl-1,1-diphenylurea is CNC(=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-methyl-1,1-diphenylurea?
The InChIKey is IMFYAZJNDOZIFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-15-14(17)16(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H,15,17).
What are the key properties of 3-methyl-1,1-diphenylurea?
3-methyl-1,1-diphenylurea has a molecular weight of 226.28 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,1-diphenylurea is sourced from PubChem (CID 25711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).