About 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone
1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone (PubChem CID 2571500) has the molecular formula C20H25N3O4S
and a molecular weight of 403.50 g/mol. Its IUPAC name is 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone |
| PubChem CID | 2571500 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)CN2CCN(S(=O)(=O)c3ccccc3)CC2)c1C |
| InChI | InChI=1S/C20H25N3O4S/c1-14-19(16(3)24)15(2)21-20(14)18(25)13-22-9-11-23(12-10-22)28(26,27)17-7-5-4-6-8-17/h4-8,21H,9-13H2,1-3H3 |
| InChIKey | LRQLVVOJGRHUOJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone?
The IUPAC name of 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone (CID 2571500) is 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone is CC(=O)c1c(C)[nH]c(C(=O)CN2CCN(S(=O)(=O)c3ccccc3)CC2)c1C.
What is the InChIKey of 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone?
The InChIKey is LRQLVVOJGRHUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O4S/c1-14-19(16(3)24)15(2)21-20(14)18(25)13-22-9-11-23(12-10-22)28(26,27)17-7-5-4-6-8-17/h4-8,21H,9-13H2,1-3H3.
What are the key properties of 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone?
1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone has a molecular weight of 403.50 g/mol, XLogP of 2.02, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-[4-(benzenesulfonyl)piperazin-1-yl]ethanone is sourced from PubChem (CID 2571500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).