C16H14ClFN2O3 — CID 2571518
[2-(5-fluoro-2-methylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 2571518) has the molecular formula C16H14ClFN2O3 and a molecular weight of 336.75 g/mol. Its IUPAC name is [2-(5-fluoro-2-methylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-(5-fluoro-2-methylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 2571518 |
| Molecular Formula | C16H14ClFN2O3 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [2-(5-fluoro-2-methylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | Cc1ccc(F)cc1NC(=O)COC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C16H14ClFN2O3/c1-9-2-4-11(18)7-14(9)20-15(21)8-23-16(22)10-3-5-12(17)13(19)6-10/h2-7H,8,19H2,1H3,(H,20,21) |
| InChIKey | IAJZOLJOORQCDW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|