C18H17F2NO3S — CID 2571522
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 2571522) has the molecular formula C18H17F2NO3S and a molecular weight of 365.40 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 2571522 |
| Molecular Formula | C18H17F2NO3S |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccc(F)cc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17F2NO3S/c19-14-3-1-13(2-4-14)11-21-17(22)12-24-18(23)9-10-25-16-7-5-15(20)6-8-16/h1-8H,9-12H2,(H,21,22) |
| InChIKey | NWYIEWGXSVCBLR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |