About [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate (PubChem CID 2571647) has the molecular formula C14H9ClF2N2O3
and a molecular weight of 326.69 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate.
Molecular Properties
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate |
| PubChem CID | 2571647 |
| Molecular Formula | C14H9ClF2N2O3 |
| Molecular Weight | 326.69 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)cc(F)c1)Nc1cccnc1Cl |
| InChI | InChI=1S/C14H9ClF2N2O3/c15-13-11(2-1-3-18-13)19-12(20)7-22-14(21)8-4-9(16)6-10(17)5-8/h1-6H,7H2,(H,19,20) |
| InChIKey | ZJRSHFLZOSPBID-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate?
The IUPAC name of [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate (CID 2571647) is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate.
What is the SMILES notation for [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate?
The canonical SMILES for [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate is O=C(COC(=O)c1cc(F)cc(F)c1)Nc1cccnc1Cl.
What is the InChIKey of [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate?
The InChIKey is ZJRSHFLZOSPBID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClF2N2O3/c15-13-11(2-1-3-18-13)19-12(20)7-22-14(21)8-4-9(16)6-10(17)5-8/h1-6H,7H2,(H,19,20).
What are the key properties of [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate?
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate has a molecular weight of 326.69 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3,5-difluorobenzoate is sourced from PubChem (CID 2571647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).