C18H18FNO3 — CID 2572118
[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2,3-dimethylbenzoate (PubChem CID 2572118) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2,3-dimethylbenzoate.
| Compound Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 2572118 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2,3-dimethylbenzoate |
| SMILES | Cc1cccc(C(=O)O[C@H](C)C(=O)Nc2ccccc2F)c1C |
| InChI | InChI=1S/C18H18FNO3/c1-11-7-6-8-14(12(11)2)18(22)23-13(3)17(21)20-16-10-5-4-9-15(16)19/h4-10,13H,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | IUPRPTNUFXYYMS-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |