About tricyclohexylstannane
tricyclohexylstannane (PubChem CID 25729) has the molecular formula C18H34Sn
and a molecular weight of 369.18 g/mol. Its IUPAC name is tricyclohexylstannane.
Molecular Properties
| Compound Name | tricyclohexylstannane |
| PubChem CID | 25729 |
| Molecular Formula | C18H34Sn |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tricyclohexylstannane |
| SMILES | C1CCC([SnH](C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/3C6H11.Sn.H/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;; |
| InChIKey | SQEBZYNJTQKFEQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclohexylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclohexylstannane?
The IUPAC name of tricyclohexylstannane (CID 25729) is tricyclohexylstannane.
What is the SMILES notation for tricyclohexylstannane?
The canonical SMILES for tricyclohexylstannane is C1CCC([SnH](C2CCCCC2)C2CCCCC2)CC1.
What is the InChIKey of tricyclohexylstannane?
The InChIKey is SQEBZYNJTQKFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H11.Sn.H/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;;.
What are the key properties of tricyclohexylstannane?
tricyclohexylstannane has a molecular weight of 369.18 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclohexylstannane is sourced from PubChem (CID 25729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).