C23H19ClN2O2 — CID 2573233
naphthalen-2-yl 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate (PubChem CID 2573233) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is naphthalen-2-yl 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | naphthalen-2-yl 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2573233 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | naphthalen-2-yl 5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate |
| SMILES | Cc1ccc(Cn2nc(C)c(C(=O)Oc3ccc4ccccc4c3)c2Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2O2/c1-15-7-9-17(10-8-15)14-26-22(24)21(16(2)25-26)23(27)28-20-12-11-18-5-3-4-6-19(18)13-20/h3-13H,14H2,1-2H3 |
| InChIKey | MBHRDCQQGUNXMW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|