About (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate
(2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate (PubChem CID 2573452) has the molecular formula C14H15N3O3
and a molecular weight of 273.29 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate |
| PubChem CID | 2573452 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)OCC(N)=O |
| InChI | InChI=1S/C14H15N3O3/c1-9-13(14(19)20-8-12(15)18)10(2)17(16-9)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H2,15,18) |
| InChIKey | LEADFGHTRMHIIG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate?
The IUPAC name of (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate (CID 2573452) is (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate.
What is the SMILES notation for (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate?
The canonical SMILES for (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate is Cc1nn(-c2ccccc2)c(C)c1C(=O)OCC(N)=O.
What is the InChIKey of (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate?
The InChIKey is LEADFGHTRMHIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3/c1-9-13(14(19)20-8-12(15)18)10(2)17(16-9)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H2,15,18).
What are the key properties of (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate?
(2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate has a molecular weight of 273.29 g/mol, XLogP of 1.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 3,5-dimethyl-1-phenylpyrazole-4-carboxylate is sourced from PubChem (CID 2573452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).