About 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide (PubChem CID 2574590) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide.
Molecular Properties
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide |
| PubChem CID | 2574590 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide |
| SMILES | Cc1noc(C)c1COc1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N2O3/c1-13-18(14(2)24-21-13)12-23-17-10-8-15(9-11-17)19(22)20-16-6-4-3-5-7-16/h3-11H,12H2,1-2H3,(H,20,22) |
| InChIKey | ZAAZJKGIODLMTJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide?
The IUPAC name of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide (CID 2574590) is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide.
What is the SMILES notation for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide?
The canonical SMILES for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide is Cc1noc(C)c1COc1ccc(C(=O)Nc2ccccc2)cc1.
What is the InChIKey of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide?
The InChIKey is ZAAZJKGIODLMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-13-18(14(2)24-21-13)12-23-17-10-8-15(9-11-17)19(22)20-16-6-4-3-5-7-16/h3-11H,12H2,1-2H3,(H,20,22).
What are the key properties of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide?
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide has a molecular weight of 322.36 g/mol, XLogP of 4.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-phenylbenzamide is sourced from PubChem (CID 2574590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).