C19H19NO4S — CID 2574630
2-(2-oxo-4-propylchromen-7-yl)oxy-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 2574630) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-(2-oxo-4-propylchromen-7-yl)oxy-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(2-oxo-4-propylchromen-7-yl)oxy-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2574630 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-(2-oxo-4-propylchromen-7-yl)oxy-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)NCc3cccs3)ccc12 |
| InChI | InChI=1S/C19H19NO4S/c1-2-4-13-9-19(22)24-17-10-14(6-7-16(13)17)23-12-18(21)20-11-15-5-3-8-25-15/h3,5-10H,2,4,11-12H2,1H3,(H,20,21) |
| InChIKey | IPIWAYBGIGHVRE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|