C17H26N3O2+ — CID 2575256
(2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 2575256) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 2575256 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCCC1)[NH+]1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-14(17(22)20-8-4-5-9-20)18-10-12-19(13-11-18)15-6-2-3-7-16(15)21/h2-3,6-7,14,21H,4-5,8-13H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | OESIKSSQRRZAOQ-CQSZACIVSA-O |
| XLogP | 0.11 |
| TPSA | 48.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |