C18H19ClFNO — CID 2575385
2-(2-chloro-6-fluorophenyl)-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 2575385) has the molecular formula C18H19ClFNO and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 2575385 |
| Molecular Formula | C18H19ClFNO |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H19ClFNO/c1-13(10-11-14-6-3-2-4-7-14)21-18(22)12-15-16(19)8-5-9-17(15)20/h2-9,13H,10-12H2,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | LCWOHVDXMHVDHU-CYBMUJFWSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |