C15H16N4O3S — CID 2576697
2-[2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 2576697) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2576697 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | CCCn1c(SCCN2C(=O)c3ccccc3C2=O)n[nH]c1=O |
| InChI | InChI=1S/C15H16N4O3S/c1-2-7-19-14(22)16-17-15(19)23-9-8-18-12(20)10-5-3-4-6-11(10)13(18)21/h3-6H,2,7-9H2,1H3,(H,16,22) |
| InChIKey | PITGZKUUTWDAJS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|