C19H17ClN4O5 — CID 2577122
2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 2577122) has the molecular formula C19H17ClN4O5 and a molecular weight of 416.82 g/mol. Its IUPAC name is 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2577122 |
| Molecular Formula | C19H17ClN4O5 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1c(NC(=O)CN2C(=O)N[C@@](C)(c3ccc(Cl)cc3)C2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17ClN4O5/c1-11-14(4-3-5-15(11)24(28)29)21-16(25)10-23-17(26)19(2,22-18(23)27)12-6-8-13(20)9-7-12/h3-9H,10H2,1-2H3,(H,21,25)(H,22,27)/t19-/m0/s1 |
| InChIKey | XUSRLUJBTKOXQV-IBGZPJMESA-N |
| XLogP | 2.96 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|