C17H29N3O3 — CID 2578454
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N,N-di(propan-2-yl)acetamide (PubChem CID 2578454) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 2578454 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)NC2(CCCCCC2)C1=O)C(C)C |
| InChI | InChI=1S/C17H29N3O3/c1-12(2)20(13(3)4)14(21)11-19-15(22)17(18-16(19)23)9-7-5-6-8-10-17/h12-13H,5-11H2,1-4H3,(H,18,23) |
| InChIKey | ZFGMABDXPGALHL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|