About N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide
N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide (PubChem CID 2578489) has the molecular formula C19H31N3O3
and a molecular weight of 349.48 g/mol. Its IUPAC name is N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
| PubChem CID | 2578489 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCCC2)C1=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H31N3O3/c23-16(20-15-10-6-2-1-3-7-11-15)14-22-17(24)19(21-18(22)25)12-8-4-5-9-13-19/h15H,1-14H2,(H,20,23)(H,21,25) |
| InChIKey | UXMLOXXUMWKXPV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide?
The IUPAC name of N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide (CID 2578489) is N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide.
What is the SMILES notation for N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide?
The canonical SMILES for N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide is O=C(CN1C(=O)NC2(CCCCCC2)C1=O)NC1CCCCCCC1.
What is the InChIKey of N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide?
The InChIKey is UXMLOXXUMWKXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O3/c23-16(20-15-10-6-2-1-3-7-11-15)14-22-17(24)19(21-18(22)25)12-8-4-5-9-13-19/h15H,1-14H2,(H,20,23)(H,21,25).
What are the key properties of N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide?
N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide has a molecular weight of 349.48 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclooctyl-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide is sourced from PubChem (CID 2578489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).