About 1,4-dihydro-3,1-benzoxazin-2-one
1,4-dihydro-3,1-benzoxazin-2-one (PubChem CID 25786) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 1,4-dihydro-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 1,4-dihydro-3,1-benzoxazin-2-one |
| PubChem CID | 25786 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 1,4-dihydro-3,1-benzoxazin-2-one |
| SMILES | O=C1Nc2ccccc2CO1 |
| InChI | InChI=1S/C8H7NO2/c10-8-9-7-4-2-1-3-6(7)5-11-8/h1-4H,5H2,(H,9,10) |
| InChIKey | SYZIUAAQNFJPJY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dihydro-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydro-3,1-benzoxazin-2-one?
The IUPAC name of 1,4-dihydro-3,1-benzoxazin-2-one (CID 25786) is 1,4-dihydro-3,1-benzoxazin-2-one.
What is the SMILES notation for 1,4-dihydro-3,1-benzoxazin-2-one?
The canonical SMILES for 1,4-dihydro-3,1-benzoxazin-2-one is O=C1Nc2ccccc2CO1.
What is the InChIKey of 1,4-dihydro-3,1-benzoxazin-2-one?
The InChIKey is SYZIUAAQNFJPJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c10-8-9-7-4-2-1-3-6(7)5-11-8/h1-4H,5H2,(H,9,10).
What are the key properties of 1,4-dihydro-3,1-benzoxazin-2-one?
1,4-dihydro-3,1-benzoxazin-2-one has a molecular weight of 149.15 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydro-3,1-benzoxazin-2-one is sourced from PubChem (CID 25786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).