C17H15N3OS — CID 2583293
(E)-N-(1H-benzimidazol-2-yl)-3-(4-methylsulfanylphenyl)prop-2-enamide (PubChem CID 2583293) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is (E)-N-(1H-benzimidazol-2-yl)-3-(4-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1H-benzimidazol-2-yl)-3-(4-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2583293 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (E)-N-(1H-benzimidazol-2-yl)-3-(4-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)Nc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C17H15N3OS/c1-22-13-9-6-12(7-10-13)8-11-16(21)20-17-18-14-4-2-3-5-15(14)19-17/h2-11H,1H3,(H2,18,19,20,21)/b11-8+ |
| InChIKey | DEQHAUAZPAUEPA-DHZHZOJOSA-N |
| XLogP | 3.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|