C21H28N4O4 — CID 2583467
N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide (PubChem CID 2583467) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide |
|---|---|
| PubChem CID | 2583467 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)CN2C(=O)NC3(CCCCCCC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H28N4O4/c1-14-8-9-16(15(2)12-14)22-19(28)23-17(26)13-25-18(27)21(24-20(25)29)10-6-4-3-5-7-11-21/h8-9,12H,3-7,10-11,13H2,1-2H3,(H,24,29)(H2,22,23,26,28) |
| InChIKey | SOMQQRGYMFVVDX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|