C14H20F3N3O3 — CID 2583584
2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 2583584) has the molecular formula C14H20F3N3O3 and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 2583584 |
| Molecular Formula | C14H20F3N3O3 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCCCC2)C1=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H20F3N3O3/c15-14(16,17)9-18-10(21)8-20-11(22)13(19-12(20)23)6-4-2-1-3-5-7-13/h1-9H2,(H,18,21)(H,19,23) |
| InChIKey | OQIBRIYXJJSXOX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|