About [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate
[2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 2584074) has the molecular formula C13H12FNO5
and a molecular weight of 281.24 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
Molecular Properties
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| PubChem CID | 2584074 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | O=C(COC(=O)C1=COCCO1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FNO5/c14-9-1-3-10(4-2-9)15-12(16)8-20-13(17)11-7-18-5-6-19-11/h1-4,7H,5-6,8H2,(H,15,16) |
| InChIKey | MIROUDGWSDPCGM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate?
The IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (CID 2584074) is [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
What is the SMILES notation for [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate?
The canonical SMILES for [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate is O=C(COC(=O)C1=COCCO1)Nc1ccc(F)cc1.
What is the InChIKey of [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate?
The InChIKey is MIROUDGWSDPCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO5/c14-9-1-3-10(4-2-9)15-12(16)8-20-13(17)11-7-18-5-6-19-11/h1-4,7H,5-6,8H2,(H,15,16).
What are the key properties of [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate?
[2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate has a molecular weight of 281.24 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoroanilino)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate is sourced from PubChem (CID 2584074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).