About 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one
4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one (PubChem CID 2585288) has the molecular formula C13H12Cl2N2O
and a molecular weight of 283.16 g/mol. Its IUPAC name is 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one |
| PubChem CID | 2585288 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one |
| SMILES | Cc1cc(C)cc(Cn2ncc(Cl)c(Cl)c2=O)c1 |
| InChI | InChI=1S/C13H12Cl2N2O/c1-8-3-9(2)5-10(4-8)7-17-13(18)12(15)11(14)6-16-17/h3-6H,7H2,1-2H3 |
| InChIKey | LQCNMWUGGBGOSX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one (CID 2585288) is 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one is Cc1cc(C)cc(Cn2ncc(Cl)c(Cl)c2=O)c1.
What is the InChIKey of 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
The InChIKey is LQCNMWUGGBGOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2O/c1-8-3-9(2)5-10(4-8)7-17-13(18)12(15)11(14)6-16-17/h3-6H,7H2,1-2H3.
What are the key properties of 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one?
4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one has a molecular weight of 283.16 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-[(3,5-dimethylphenyl)methyl]pyridazin-3-one is sourced from PubChem (CID 2585288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).