C24H23N3O3S — CID 2585294
N-(furan-2-ylmethyl)-2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 2585294) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2585294 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)c1ccccc1-n1c(SCC(=O)NCc2ccco2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H23N3O3S/c1-16(2)18-9-4-6-12-21(18)27-23(29)19-10-3-5-11-20(19)26-24(27)31-15-22(28)25-14-17-8-7-13-30-17/h3-13,16H,14-15H2,1-2H3,(H,25,28) |
| InChIKey | IIPNJBDZMMNIHC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |