C23H27NO4 — CID 2585306
[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-butoxybenzoate (PubChem CID 2585306) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-butoxybenzoate.
| Compound Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 2585306 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)N[C@@H]2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-2-3-15-27-19-13-11-18(12-14-19)23(26)28-16-22(25)24-21-10-6-8-17-7-4-5-9-20(17)21/h4-5,7,9,11-14,21H,2-3,6,8,10,15-16H2,1H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | HGIZETYDMGFUJG-OAQYLSRUSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|