C22H25N3O3 — CID 2586807
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(3-methylbutyl)acetamide (PubChem CID 2586807) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(3-methylbutyl)acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 2586807 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H25N3O3/c1-16(2)13-14-23-19(26)15-25-20(27)22(24-21(25)28,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16H,13-15H2,1-2H3,(H,23,26)(H,24,28) |
| InChIKey | MKMHMYWGKWVNPL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|