C11H12F3N5OS — CID 2586978
2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 2586978) has the molecular formula C11H12F3N5OS and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 2586978 |
| Molecular Formula | C11H12F3N5OS |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1cc(C)n2nc(SCC(=O)NCC(F)(F)F)nc2n1 |
| InChI | InChI=1S/C11H12F3N5OS/c1-6-3-7(2)19-9(16-6)17-10(18-19)21-4-8(20)15-5-11(12,13)14/h3H,4-5H2,1-2H3,(H,15,20) |
| InChIKey | AGCFWMQBJXPGRC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |