C16H13N5O2S — CID 2587014
2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 2587014) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2587014 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)n2nc(SCN3C(=O)c4ccccc4C3=O)nc2n1 |
| InChI | InChI=1S/C16H13N5O2S/c1-9-7-10(2)21-15(17-9)18-16(19-21)24-8-20-13(22)11-5-3-4-6-12(11)14(20)23/h3-7H,8H2,1-2H3 |
| InChIKey | PZTJXZRLZPUTPC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|