C15H12F3N5OS — CID 2587266
2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2587266) has the molecular formula C15H12F3N5OS and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2587266 |
| Molecular Formula | C15H12F3N5OS |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1cc(C)n2nc(SCC(=O)Nc3ccc(F)c(F)c3F)nc2n1 |
| InChI | InChI=1S/C15H12F3N5OS/c1-7-5-8(2)23-14(19-7)21-15(22-23)25-6-11(24)20-10-4-3-9(16)12(17)13(10)18/h3-5H,6H2,1-2H3,(H,20,24) |
| InChIKey | ONUOFIWXIWIZIQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|