C24H27N3O4S2 — CID 2589911
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide (PubChem CID 2589911) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2589911 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCCc2ccc(OC)c(OC)c2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C24H27N3O4S2/c1-4-12-27-23(29)21-16-6-5-7-19(16)33-22(21)26-24(27)32-14-20(28)25-11-10-15-8-9-17(30-2)18(13-15)31-3/h4,8-9,13H,1,5-7,10-12,14H2,2-3H3,(H,25,28) |
| InChIKey | HLGSRUCNWHVYJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|