About 1-methylbenzotriazole
1-methylbenzotriazole (PubChem CID 25902) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 1-methylbenzotriazole.
Molecular Properties
| Compound Name | 1-methylbenzotriazole |
| PubChem CID | 25902 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 1-methylbenzotriazole |
| SMILES | Cn1nnc2ccccc21 |
| InChI | InChI=1S/C7H7N3/c1-10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3 |
| InChIKey | HXQHRUJXQJEGER-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylbenzotriazole?
The IUPAC name of 1-methylbenzotriazole (CID 25902) is 1-methylbenzotriazole.
What is the SMILES notation for 1-methylbenzotriazole?
The canonical SMILES for 1-methylbenzotriazole is Cn1nnc2ccccc21.
What is the InChIKey of 1-methylbenzotriazole?
The InChIKey is HXQHRUJXQJEGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3.
What are the key properties of 1-methylbenzotriazole?
1-methylbenzotriazole has a molecular weight of 133.15 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylbenzotriazole is sourced from PubChem (CID 25902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).