About 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide
2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 2591248) has the molecular formula C17H14FN3O3S2
and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
Molecular Properties
| Compound Name | 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| PubChem CID | 2591248 |
| Molecular Formula | C17H14FN3O3S2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | O=C(CSc1nc(-c2ccc(F)cc2)cs1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H14FN3O3S2/c18-12-5-3-11(4-6-12)14-9-25-17(20-14)26-10-15(22)21-16(23)19-8-13-2-1-7-24-13/h1-7,9H,8,10H2,(H2,19,21,22,23) |
| InChIKey | OYDVEOBDCKEERN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
The IUPAC name of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide (CID 2591248) is 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
What is the SMILES notation for 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
The canonical SMILES for 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide is O=C(CSc1nc(-c2ccc(F)cc2)cs1)NC(=O)NCc1ccco1.
What is the InChIKey of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
The InChIKey is OYDVEOBDCKEERN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3O3S2/c18-12-5-3-11(4-6-12)14-9-25-17(20-14)26-10-15(22)21-16(23)19-8-13-2-1-7-24-13/h1-7,9H,8,10H2,(H2,19,21,22,23).
What are the key properties of 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide has a molecular weight of 391.45 g/mol, XLogP of 3.66, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide is sourced from PubChem (CID 2591248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).