About (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide
(2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide (PubChem CID 2591448) has the molecular formula C15H12Cl2FNOS
and a molecular weight of 344.24 g/mol. Its IUPAC name is (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide.
Molecular Properties
| Compound Name | (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide |
| PubChem CID | 2591448 |
| Molecular Formula | C15H12Cl2FNOS |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1ccccc1F)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FNOS/c1-9(21-14-5-3-2-4-12(14)18)15(20)19-13-7-6-10(16)8-11(13)17/h2-9H,1H3,(H,19,20)/t9-/m0/s1 |
| InChIKey | LCUBMLDEXIVQNK-VIFPVBQESA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide?
The IUPAC name of (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide (CID 2591448) is (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide.
What is the SMILES notation for (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide?
The canonical SMILES for (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide is C[C@H](Sc1ccccc1F)C(=O)Nc1ccc(Cl)cc1Cl.
What is the InChIKey of (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide?
The InChIKey is LCUBMLDEXIVQNK-VIFPVBQESA-N. The full InChI is InChI=1S/C15H12Cl2FNOS/c1-9(21-14-5-3-2-4-12(14)18)15(20)19-13-7-6-10(16)8-11(13)17/h2-9H,1H3,(H,19,20)/t9-/m0/s1.
What are the key properties of (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide?
(2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide has a molecular weight of 344.24 g/mol, XLogP of 5.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(2,4-dichlorophenyl)-2-(2-fluorophenyl)sulfanylpropanamide is sourced from PubChem (CID 2591448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).