C19H23N3O4 — CID 2592750
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-ethyl-3-methylquinoline-4-carboxylate (PubChem CID 2592750) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-ethyl-3-methylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2592750 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)c1c(C)c(CC)nc2ccccc12 |
| InChI | InChI=1S/C19H23N3O4/c1-4-10-20-19(25)22-16(23)11-26-18(24)17-12(3)14(5-2)21-15-9-7-6-8-13(15)17/h6-9H,4-5,10-11H2,1-3H3,(H2,20,22,23,25) |
| InChIKey | YZAGLWIKDOQHRL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |