C19H17N5O2S — CID 2594362
4-(1H-benzimidazol-2-ylsulfanyl)-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide (PubChem CID 2594362) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2594362 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2[nH]1)Nc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H17N5O2S/c25-16(22-18-24-23-17(26-18)13-7-2-1-3-8-13)11-6-12-27-19-20-14-9-4-5-10-15(14)21-19/h1-5,7-10H,6,11-12H2,(H,20,21)(H,22,24,25) |
| InChIKey | SBLSMWVFOZQVEQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|