C16H15ClN2O4 — CID 2594596
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate (PubChem CID 2594596) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 2594596 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(3-methylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)OCC(=O)Nc2cccnc2Cl)c1 |
| InChI | InChI=1S/C16H15ClN2O4/c1-11-4-2-5-12(8-11)22-10-15(21)23-9-14(20)19-13-6-3-7-18-16(13)17/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | WPQYPFIBVSQPNB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|