C19H20N2O5S — CID 2596990
N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 2596990) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2596990 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc2nc(NC(=O)Cc3cc(OC)c(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C19H20N2O5S/c1-23-12-5-6-13-16(10-12)27-19(20-13)21-17(22)9-11-7-14(24-2)18(26-4)15(8-11)25-3/h5-8,10H,9H2,1-4H3,(H,20,21,22) |
| InChIKey | WLZFXMFGEYCWGU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |